C35H19F11O2 — CID 138458804
2-[6-[4-[[5,7-difluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxy-difluoromethyl]-3,5-difluorophenyl]-5,7-difluoronaphthalen-2-yl]oxane (PubChem CID 138458804) has the molecular formula C35H19F11O2 and a molecular weight of 680.51 g/mol. Its IUPAC name is 2-[6-[4-[[5,7-difluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxy-difluoromethyl]-3,5-difluorophenyl]-5,7-difluoronaphthalen-2-yl]oxane.
| Compound Name | 2-[6-[4-[[5,7-difluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxy-difluoromethyl]-3,5-difluorophenyl]-5,7-difluoronaphthalen-2-yl]oxane |
|---|---|
| PubChem CID | 138458804 |
| Molecular Formula | C35H19F11O2 |
| Molecular Weight | 680.51 g/mol |
| Exact Mass | 680.12 |
| IUPAC Name | 2-[6-[4-[[5,7-difluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxy-difluoromethyl]-3,5-difluorophenyl]-5,7-difluoronaphthalen-2-yl]oxane |
| SMILES | Fc1cc2cc(OC(F)(F)c3c(F)cc(-c4c(F)cc5cc(C6CCCCO6)ccc5c4F)cc3F)ccc2c(F)c1C#CC(F)(F)F |
| InChI | InChI=1S/C35H19F11O2/c36-25-13-19-12-21(5-7-22(19)32(40)24(25)8-9-34(42,43)44)48-35(45,46)31-27(38)15-20(16-28(31)39)30-26(37)14-18-11-17(4-6-23(18)33(30)41)29-3-1-2-10-47-29/h4-7,11-16,29H,1-3,10H2 |
| InChIKey | NETGVPVAFQNUNB-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.51 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|