C35H13F12NO — CID 138459055
2-[6-[4-[difluoro-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxymethyl]-3,5-difluorophenyl]-5,7-difluoronaphthalen-2-yl]pyridine (PubChem CID 138459055) has the molecular formula C35H13F12NO and a molecular weight of 691.47 g/mol. Its IUPAC name is 2-[6-[4-[difluoro-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxymethyl]-3,5-difluorophenyl]-5,7-difluoronaphthalen-2-yl]pyridine.
| Compound Name | 2-[6-[4-[difluoro-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxymethyl]-3,5-difluorophenyl]-5,7-difluoronaphthalen-2-yl]pyridine |
|---|---|
| PubChem CID | 138459055 |
| Molecular Formula | C35H13F12NO |
| Molecular Weight | 691.47 g/mol |
| Exact Mass | 691.08 |
| IUPAC Name | 2-[6-[4-[difluoro-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxymethyl]-3,5-difluorophenyl]-5,7-difluoronaphthalen-2-yl]pyridine |
| SMILES | Fc1cc2cc(OC(F)(F)c3c(F)cc(-c4c(F)cc5cc(-c6ccccn6)ccc5c4F)cc3F)cc(F)c2c(F)c1C#CC(F)(F)F |
| InChI | InChI=1S/C35H13F12NO/c36-23-12-18-10-20(15-25(38)29(18)33(42)22(23)6-7-34(43,44)45)49-35(46,47)31-26(39)13-19(14-27(31)40)30-24(37)11-17-9-16(4-5-21(17)32(30)41)28-3-1-2-8-48-28/h1-5,8-15H |
| InChIKey | DJXFKBNEEGENFS-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.47 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|