C20H20IN5O3 — CID 138459059
methyl 2-[[3-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]cyclobutyl]methoxy]-5-iodobenzoate (PubChem CID 138459059) has the molecular formula C20H20IN5O3 and a molecular weight of 505.32 g/mol. Its IUPAC name is methyl 2-[[3-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]cyclobutyl]methoxy]-5-iodobenzoate.
| Compound Name | methyl 2-[[3-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]cyclobutyl]methoxy]-5-iodobenzoate |
|---|---|
| PubChem CID | 138459059 |
| Molecular Formula | C20H20IN5O3 |
| Molecular Weight | 505.32 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | methyl 2-[[3-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]cyclobutyl]methoxy]-5-iodobenzoate |
| SMILES | COC(=O)c1cc(I)ccc1OCC1CC(n2cnnc2-c2cccc(N)n2)C1 |
| InChI | InChI=1S/C20H20IN5O3/c1-28-20(27)15-9-13(21)5-6-17(15)29-10-12-7-14(8-12)26-11-23-25-19(26)16-3-2-4-18(22)24-16/h2-6,9,11-12,14H,7-8,10H2,1H3,(H2,22,24) |
| InChIKey | GKOQTNFCDWVZGX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|