C19H20BrN5O4 — CID 138459239
2-[4-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]butoxy]-4-bromo-5-methoxybenzoic acid (PubChem CID 138459239) has the molecular formula C19H20BrN5O4 and a molecular weight of 462.30 g/mol. Its IUPAC name is 2-[4-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]butoxy]-4-bromo-5-methoxybenzoic acid.
| Compound Name | 2-[4-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]butoxy]-4-bromo-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 138459239 |
| Molecular Formula | C19H20BrN5O4 |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 2-[4-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]butoxy]-4-bromo-5-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)c(OCCCCn2cnnc2-c2cccc(N)n2)cc1Br |
| InChI | InChI=1S/C19H20BrN5O4/c1-28-16-9-12(19(26)27)15(10-13(16)20)29-8-3-2-7-25-11-22-24-18(25)14-5-4-6-17(21)23-14/h4-6,9-11H,2-3,7-8H2,1H3,(H2,21,23)(H,26,27) |
| InChIKey | YFXCSFYAVVLLDK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|