C14H27N — CID 138459744
4-nonan-5-yl-1,2,3,6-tetrahydropyridine (PubChem CID 138459744) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is 4-nonan-5-yl-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-nonan-5-yl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 138459744 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 4-nonan-5-yl-1,2,3,6-tetrahydropyridine |
| SMILES | CCCCC(CCCC)C1=CCNCC1 |
| InChI | InChI=1S/C14H27N/c1-3-5-7-13(8-6-4-2)14-9-11-15-12-10-14/h9,13,15H,3-8,10-12H2,1-2H3 |
| InChIKey | OEQLDQZLEFCRLO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|