C10H14ClNO — CID 138460333
5-[(1Z)-3-chloro-2-methylbuta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-1,4-oxazine (PubChem CID 138460333) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is 5-[(1Z)-3-chloro-2-methylbuta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-1,4-oxazine.
| Compound Name | 5-[(1Z)-3-chloro-2-methylbuta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-1,4-oxazine |
|---|---|
| PubChem CID | 138460333 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 5-[(1Z)-3-chloro-2-methylbuta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-1,4-oxazine |
| SMILES | C=C(Cl)/C(C)=C\C1=C(C)OCCN1 |
| InChI | InChI=1S/C10H14ClNO/c1-7(8(2)11)6-10-9(3)13-5-4-12-10/h6,12H,2,4-5H2,1,3H3/b7-6- |
| InChIKey | ZEZUEHPBYAKPDK-SREVYHEPSA-N |
| XLogP | 2.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|