C14H15ClN4O2 — CID 138460504
4-(7-chloro-2,3-dihydro-1,4-benzoxazine-4-carbonyl)piperazine-1-carbonitrile (PubChem CID 138460504) has the molecular formula C14H15ClN4O2 and a molecular weight of 306.75 g/mol. Its IUPAC name is 4-(7-chloro-2,3-dihydro-1,4-benzoxazine-4-carbonyl)piperazine-1-carbonitrile.
| Compound Name | 4-(7-chloro-2,3-dihydro-1,4-benzoxazine-4-carbonyl)piperazine-1-carbonitrile |
|---|---|
| PubChem CID | 138460504 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-(7-chloro-2,3-dihydro-1,4-benzoxazine-4-carbonyl)piperazine-1-carbonitrile |
| SMILES | N#CN1CCN(C(=O)N2CCOc3cc(Cl)ccc32)CC1 |
| InChI | InChI=1S/C14H15ClN4O2/c15-11-1-2-12-13(9-11)21-8-7-19(12)14(20)18-5-3-17(10-16)4-6-18/h1-2,9H,3-8H2 |
| InChIKey | DWAUWPGOHCFZRH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 59.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|