C16H20ClN5O2 — CID 138460639
2-(7-chloro-3-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-2,6-diazaspiro[3.3]heptane-6-carboximidamide (PubChem CID 138460639) has the molecular formula C16H20ClN5O2 and a molecular weight of 349.82 g/mol. Its IUPAC name is 2-(7-chloro-3-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-2,6-diazaspiro[3.3]heptane-6-carboximidamide.
| Compound Name | 2-(7-chloro-3-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-2,6-diazaspiro[3.3]heptane-6-carboximidamide |
|---|---|
| PubChem CID | 138460639 |
| Molecular Formula | C16H20ClN5O2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-(7-chloro-3-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-2,6-diazaspiro[3.3]heptane-6-carboximidamide |
| SMILES | [H]/N=C(\N)N1CC2(CN(C(=O)N3c4ccc(Cl)cc4OCC3C)C2)C1 |
| InChI | InChI=1S/C16H20ClN5O2/c1-10-5-24-13-4-11(17)2-3-12(13)22(10)15(23)21-8-16(9-21)6-20(7-16)14(18)19/h2-4,10H,5-9H2,1H3,(H3,18,19) |
| InChIKey | UABHJCFVXVHWAX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|