About N-tert-butyl-4-[2-(tert-butylamino)ethoxy]-3,3-difluorobutan-1-amine
N-tert-butyl-4-[2-(tert-butylamino)ethoxy]-3,3-difluorobutan-1-amine (PubChem CID 138460818) has the molecular formula C14H30F2N2O
and a molecular weight of 280.40 g/mol. Its IUPAC name is N-tert-butyl-4-[2-(tert-butylamino)ethoxy]-3,3-difluorobutan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-4-[2-(tert-butylamino)ethoxy]-3,3-difluorobutan-1-amine |
| PubChem CID | 138460818 |
| Molecular Formula | C14H30F2N2O |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | N-tert-butyl-4-[2-(tert-butylamino)ethoxy]-3,3-difluorobutan-1-amine |
| SMILES | CC(C)(C)NCCOCC(F)(F)CCNC(C)(C)C |
| InChI | InChI=1S/C14H30F2N2O/c1-12(2,3)17-8-7-14(15,16)11-19-10-9-18-13(4,5)6/h17-18H,7-11H2,1-6H3 |
| InChIKey | WGMNZYDDKBYILU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-4-[2-(tert-butylamino)ethoxy]-3,3-difluorobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-4-[2-(tert-butylamino)ethoxy]-3,3-difluorobutan-1-amine?
The IUPAC name of N-tert-butyl-4-[2-(tert-butylamino)ethoxy]-3,3-difluorobutan-1-amine (CID 138460818) is N-tert-butyl-4-[2-(tert-butylamino)ethoxy]-3,3-difluorobutan-1-amine.
What is the SMILES notation for N-tert-butyl-4-[2-(tert-butylamino)ethoxy]-3,3-difluorobutan-1-amine?
The canonical SMILES for N-tert-butyl-4-[2-(tert-butylamino)ethoxy]-3,3-difluorobutan-1-amine is CC(C)(C)NCCOCC(F)(F)CCNC(C)(C)C.
What is the InChIKey of N-tert-butyl-4-[2-(tert-butylamino)ethoxy]-3,3-difluorobutan-1-amine?
The InChIKey is WGMNZYDDKBYILU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30F2N2O/c1-12(2,3)17-8-7-14(15,16)11-19-10-9-18-13(4,5)6/h17-18H,7-11H2,1-6H3.
What are the key properties of N-tert-butyl-4-[2-(tert-butylamino)ethoxy]-3,3-difluorobutan-1-amine?
N-tert-butyl-4-[2-(tert-butylamino)ethoxy]-3,3-difluorobutan-1-amine has a molecular weight of 280.40 g/mol, XLogP of 2.80, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-4-[2-(tert-butylamino)ethoxy]-3,3-difluorobutan-1-amine is sourced from PubChem (CID 138460818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).