C34H43F2N7O3 — CID 138461000
tert-butyl (2R)-4-[C-[6-(2-amino-6-fluorophenyl)-5-fluoro-2-[formyl-(4-methyl-2-propan-2-yl-3-pyridinyl)amino]-3-pyridinyl]-N-methylcarbonimidoyl]-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 138461000) has the molecular formula C34H43F2N7O3 and a molecular weight of 635.76 g/mol. Its IUPAC name is tert-butyl (2R)-4-[C-[6-(2-amino-6-fluorophenyl)-5-fluoro-2-[formyl-(4-methyl-2-propan-2-yl-3-pyridinyl)amino]-3-pyridinyl]-N-methylcarbonimidoyl]-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-[C-[6-(2-amino-6-fluorophenyl)-5-fluoro-2-[formyl-(4-methyl-2-propan-2-yl-3-pyridinyl)amino]-3-pyridinyl]-N-methylcarbonimidoyl]-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 138461000 |
| Molecular Formula | C34H43F2N7O3 |
| Molecular Weight | 635.76 g/mol |
| Exact Mass | 635.34 |
| IUPAC Name | tert-butyl (2R)-4-[C-[6-(2-amino-6-fluorophenyl)-5-fluoro-2-[formyl-(4-methyl-2-propan-2-yl-3-pyridinyl)amino]-3-pyridinyl]-N-methylcarbonimidoyl]-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | C/N=C(/c1cc(F)c(-c2c(N)cccc2F)nc1N(C=O)c1c(C)ccnc1C(C)C)N1C[C@@H](C)N(C(=O)OC(C)(C)C)CC1C |
| InChI | InChI=1S/C34H43F2N7O3/c1-19(2)28-30(20(3)13-14-39-28)43(18-44)32-23(15-25(36)29(40-32)27-24(35)11-10-12-26(27)37)31(38-9)41-16-22(5)42(17-21(41)4)33(45)46-34(6,7)8/h10-15,18-19,21-22H,16-17,37H2,1-9H3/b38-31-/t21?,22-/m1/s1 |
| InChIKey | JICOYHARCGBAIX-RPJOLRKUSA-N |
| XLogP | 6.44 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.76 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|