C19H25N9S — CID 138461050
2-(4-hydrazinylphenyl)sulfanyl-6-(4-methylpiperazin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine (PubChem CID 138461050) has the molecular formula C19H25N9S and a molecular weight of 411.54 g/mol. Its IUPAC name is 2-(4-hydrazinylphenyl)sulfanyl-6-(4-methylpiperazin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine.
| Compound Name | 2-(4-hydrazinylphenyl)sulfanyl-6-(4-methylpiperazin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 138461050 |
| Molecular Formula | C19H25N9S |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 2-(4-hydrazinylphenyl)sulfanyl-6-(4-methylpiperazin-1-yl)-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine |
| SMILES | Cc1cc(Nc2cc(N3CCN(C)CC3)nc(Sc3ccc(NN)cc3)n2)n[nH]1 |
| InChI | InChI=1S/C19H25N9S/c1-13-11-17(26-25-13)21-16-12-18(28-9-7-27(2)8-10-28)23-19(22-16)29-15-5-3-14(24-20)4-6-15/h3-6,11-12,24H,7-10,20H2,1-2H3,(H2,21,22,23,25,26) |
| InChIKey | CUHDUNZQRJSTDY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|