C43H32F3N5 — CID 138461288
8-[4-(8-methyl-8,9-dihydro-7H-fluoren-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-5-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-2-(trifluoromethyl)-1,6-naphthyridine (PubChem CID 138461288) has the molecular formula C43H32F3N5 and a molecular weight of 675.76 g/mol. Its IUPAC name is 8-[4-(8-methyl-8,9-dihydro-7H-fluoren-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-5-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-2-(trifluoromethyl)-1,6-naphthyridine.
| Compound Name | 8-[4-(8-methyl-8,9-dihydro-7H-fluoren-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-5-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-2-(trifluoromethyl)-1,6-naphthyridine |
|---|---|
| PubChem CID | 138461288 |
| Molecular Formula | C43H32F3N5 |
| Molecular Weight | 675.76 g/mol |
| Exact Mass | 675.26 |
| IUPAC Name | 8-[4-(8-methyl-8,9-dihydro-7H-fluoren-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-5-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-2-(trifluoromethyl)-1,6-naphthyridine |
| SMILES | CC1CC=CC2=C1Cc1c2cccc1-c1nc(-c2ccccc2)nc(-c2cnc(-c3ccc4c(c3)C3CCC4C3)c3ccc(C(F)(F)F)nc23)n1 |
| InChI | InChI=1S/C43H32F3N5/c1-23-7-5-10-29-30-11-6-12-31(35(30)21-33(23)29)41-49-40(24-8-3-2-4-9-24)50-42(51-41)36-22-47-38(32-17-18-37(43(44,45)46)48-39(32)36)27-15-16-28-25-13-14-26(19-25)34(28)20-27/h2-6,8-12,15-18,20,22-23,25-26H,7,13-14,19,21H2,1H3 |
| InChIKey | DYIPFHNROPMVOZ-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.76 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |