C45H39FN4 — CID 138461304
N'-benzyl-N-[(4-carbazol-9-ylphenyl)methylidene]-4-fluoro-6-(1,1,3,3-tetramethyl-2H-inden-5-yl)pyridine-3-carboximidamide (PubChem CID 138461304) has the molecular formula C45H39FN4 and a molecular weight of 654.83 g/mol. Its IUPAC name is N'-benzyl-N-[(4-carbazol-9-ylphenyl)methylidene]-4-fluoro-6-(1,1,3,3-tetramethyl-2H-inden-5-yl)pyridine-3-carboximidamide.
| Compound Name | N'-benzyl-N-[(4-carbazol-9-ylphenyl)methylidene]-4-fluoro-6-(1,1,3,3-tetramethyl-2H-inden-5-yl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 138461304 |
| Molecular Formula | C45H39FN4 |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.32 |
| IUPAC Name | N'-benzyl-N-[(4-carbazol-9-ylphenyl)methylidene]-4-fluoro-6-(1,1,3,3-tetramethyl-2H-inden-5-yl)pyridine-3-carboximidamide |
| SMILES | CC1(C)CC(C)(C)c2cc(-c3cc(F)c(C(/N=C/c4ccc(-n5c6ccccc6c6ccccc65)cc4)=N\Cc4ccccc4)cn3)ccc21 |
| InChI | InChI=1S/C45H39FN4/c1-44(2)29-45(3,4)38-24-32(20-23-37(38)44)40-25-39(46)36(28-47-40)43(48-26-30-12-6-5-7-13-30)49-27-31-18-21-33(22-19-31)50-41-16-10-8-14-34(41)35-15-9-11-17-42(35)50/h5-25,27-28H,26,29H2,1-4H3/b48-43+,49-27+ |
| InChIKey | FUSKKOYDAHQPNS-KNMKNRIRSA-N |
| XLogP | 11.01 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|