C25H35N5O4S — CID 138461554
tert-butyl N-(1,1-dioxothietan-3-yl)-N-[4-[2-(ethylaminomethyl)imidazo[4,5-c]quinolin-1-yl]butyl]carbamate (PubChem CID 138461554) has the molecular formula C25H35N5O4S and a molecular weight of 501.65 g/mol. Its IUPAC name is tert-butyl N-(1,1-dioxothietan-3-yl)-N-[4-[2-(ethylaminomethyl)imidazo[4,5-c]quinolin-1-yl]butyl]carbamate.
| Compound Name | tert-butyl N-(1,1-dioxothietan-3-yl)-N-[4-[2-(ethylaminomethyl)imidazo[4,5-c]quinolin-1-yl]butyl]carbamate |
|---|---|
| PubChem CID | 138461554 |
| Molecular Formula | C25H35N5O4S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | tert-butyl N-(1,1-dioxothietan-3-yl)-N-[4-[2-(ethylaminomethyl)imidazo[4,5-c]quinolin-1-yl]butyl]carbamate |
| SMILES | CCNCc1nc2cnc3ccccc3c2n1CCCCN(C(=O)OC(C)(C)C)C1CS(=O)(=O)C1 |
| InChI | InChI=1S/C25H35N5O4S/c1-5-26-15-22-28-21-14-27-20-11-7-6-10-19(20)23(21)30(22)13-9-8-12-29(18-16-35(32,33)17-18)24(31)34-25(2,3)4/h6-7,10-11,14,18,26H,5,8-9,12-13,15-17H2,1-4H3 |
| InChIKey | XWAJXNXDBSXUQL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|