C7H7N5O — CID 138461818
4-amino-3,7-dihydropyrimido[4,5-e][1,4]diazepin-2-one (PubChem CID 138461818) has the molecular formula C7H7N5O and a molecular weight of 177.17 g/mol. Its IUPAC name is 4-amino-3,7-dihydropyrimido[4,5-e][1,4]diazepin-2-one.
| Compound Name | 4-amino-3,7-dihydropyrimido[4,5-e][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 138461818 |
| Molecular Formula | C7H7N5O |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 4-amino-3,7-dihydropyrimido[4,5-e][1,4]diazepin-2-one |
| SMILES | Nc1[nH]c(=O)nc2c1C=NCC=N2 |
| InChI | InChI=1S/C7H7N5O/c8-5-4-3-9-1-2-10-6(4)12-7(13)11-5/h2-3H,1H2,(H3,8,11,12,13) |
| InChIKey | YJGCVEHPSOITEH-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |