C28H40ClFN6O3 — CID 138462327
tert-butyl (2S,6R)-4-[7-chloro-1-[(Z,5S)-3,6-dimethyl-5-(methylideneamino)hept-2-en-4-yl]-6-fluoro-2-oxopyrido[2,3-d]pyrimidin-4-yl]-2,6-dimethylpiperazine-1-carboxylate (PubChem CID 138462327) has the molecular formula C28H40ClFN6O3 and a molecular weight of 563.12 g/mol. Its IUPAC name is tert-butyl (2S,6R)-4-[7-chloro-1-[(Z,5S)-3,6-dimethyl-5-(methylideneamino)hept-2-en-4-yl]-6-fluoro-2-oxopyrido[2,3-d]pyrimidin-4-yl]-2,6-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S,6R)-4-[7-chloro-1-[(Z,5S)-3,6-dimethyl-5-(methylideneamino)hept-2-en-4-yl]-6-fluoro-2-oxopyrido[2,3-d]pyrimidin-4-yl]-2,6-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 138462327 |
| Molecular Formula | C28H40ClFN6O3 |
| Molecular Weight | 563.12 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | tert-butyl (2S,6R)-4-[7-chloro-1-[(Z,5S)-3,6-dimethyl-5-(methylideneamino)hept-2-en-4-yl]-6-fluoro-2-oxopyrido[2,3-d]pyrimidin-4-yl]-2,6-dimethylpiperazine-1-carboxylate |
| SMILES | C=N[C@@H](C(C)C)C(/C(C)=C\C)n1c(=O)nc(N2C[C@@H](C)N(C(=O)OC(C)(C)C)[C@@H](C)C2)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C28H40ClFN6O3/c1-11-16(4)22(21(31-10)15(2)3)36-25-19(12-20(30)23(29)32-25)24(33-26(36)37)34-13-17(5)35(18(6)14-34)27(38)39-28(7,8)9/h11-12,15,17-18,21-22H,10,13-14H2,1-9H3/b16-11-/t17-,18+,21-,22?/m0/s1 |
| InChIKey | NRRWJJNZAHZZLX-FOJRPXSDSA-N |
| XLogP | 5.65 |
| TPSA | 92.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.12 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|