About 1-tert-butyl-4-(1,1-difluoroethyl)imidazole
1-tert-butyl-4-(1,1-difluoroethyl)imidazole (PubChem CID 138462394) has the molecular formula C9H14F2N2
and a molecular weight of 188.22 g/mol. Its IUPAC name is 1-tert-butyl-4-(1,1-difluoroethyl)imidazole.
Molecular Properties
| Compound Name | 1-tert-butyl-4-(1,1-difluoroethyl)imidazole |
| PubChem CID | 138462394 |
| Molecular Formula | C9H14F2N2 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 1-tert-butyl-4-(1,1-difluoroethyl)imidazole |
| SMILES | CC(F)(F)c1cn(C(C)(C)C)cn1 |
| InChI | InChI=1S/C9H14F2N2/c1-8(2,3)13-5-7(12-6-13)9(4,10)11/h5-6H,1-4H3 |
| InChIKey | DFQRFGSSXDGLNJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-4-(1,1-difluoroethyl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-(1,1-difluoroethyl)imidazole?
The IUPAC name of 1-tert-butyl-4-(1,1-difluoroethyl)imidazole (CID 138462394) is 1-tert-butyl-4-(1,1-difluoroethyl)imidazole.
What is the SMILES notation for 1-tert-butyl-4-(1,1-difluoroethyl)imidazole?
The canonical SMILES for 1-tert-butyl-4-(1,1-difluoroethyl)imidazole is CC(F)(F)c1cn(C(C)(C)C)cn1.
What is the InChIKey of 1-tert-butyl-4-(1,1-difluoroethyl)imidazole?
The InChIKey is DFQRFGSSXDGLNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2N2/c1-8(2,3)13-5-7(12-6-13)9(4,10)11/h5-6H,1-4H3.
What are the key properties of 1-tert-butyl-4-(1,1-difluoroethyl)imidazole?
1-tert-butyl-4-(1,1-difluoroethyl)imidazole has a molecular weight of 188.22 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-(1,1-difluoroethyl)imidazole is sourced from PubChem (CID 138462394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).