C30H37ClN6O3 — CID 138463997
2-amino-6-chloro-8-[3-[(Z)-[[2-(dimethylamino)-2-oxoethyl]-methylhydrazinylidene]methyl]-4-formylphenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide (PubChem CID 138463997) has the molecular formula C30H37ClN6O3 and a molecular weight of 565.12 g/mol. Its IUPAC name is 2-amino-6-chloro-8-[3-[(Z)-[[2-(dimethylamino)-2-oxoethyl]-methylhydrazinylidene]methyl]-4-formylphenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide.
| Compound Name | 2-amino-6-chloro-8-[3-[(Z)-[[2-(dimethylamino)-2-oxoethyl]-methylhydrazinylidene]methyl]-4-formylphenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 138463997 |
| Molecular Formula | C30H37ClN6O3 |
| Molecular Weight | 565.12 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | 2-amino-6-chloro-8-[3-[(Z)-[[2-(dimethylamino)-2-oxoethyl]-methylhydrazinylidene]methyl]-4-formylphenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1=Cc2c(Cl)cc(-c3ccc(C=O)c(/C=N\N(C)CC(=O)N(C)C)c3)cc2N=C(N)C1 |
| InChI | InChI=1S/C30H37ClN6O3/c1-6-10-37(11-7-2)30(40)23-13-25-26(31)14-22(15-27(25)34-28(32)16-23)20-8-9-21(19-38)24(12-20)17-33-36(5)18-29(39)35(3)4/h8-9,12-15,17,19H,6-7,10-11,16,18H2,1-5H3,(H2,32,34)/b33-17- |
| InChIKey | ZDTXTLSJDWBGBR-FZPRHHONSA-N |
| XLogP | 4.60 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.12 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|