About 2-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)quinoline
2-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)quinoline (PubChem CID 138464254) has the molecular formula C22H25N
and a molecular weight of 303.45 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)quinoline.
Molecular Properties
| Compound Name | 2-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)quinoline |
| PubChem CID | 138464254 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)quinoline |
| SMILES | Cc1cc(C)cc(-c2ccc3cc(CC(C)(C)C)ccc3n2)c1 |
| InChI | InChI=1S/C22H25N/c1-15-10-16(2)12-19(11-15)21-9-7-18-13-17(14-22(3,4)5)6-8-20(18)23-21/h6-13H,14H2,1-5H3 |
| InChIKey | MTZWKZQXRYVYDA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)quinoline?
The IUPAC name of 2-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)quinoline (CID 138464254) is 2-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)quinoline.
What is the SMILES notation for 2-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)quinoline?
The canonical SMILES for 2-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)quinoline is Cc1cc(C)cc(-c2ccc3cc(CC(C)(C)C)ccc3n2)c1.
What is the InChIKey of 2-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)quinoline?
The InChIKey is MTZWKZQXRYVYDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N/c1-15-10-16(2)12-19(11-15)21-9-7-18-13-17(14-22(3,4)5)6-8-20(18)23-21/h6-13H,14H2,1-5H3.
What are the key properties of 2-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)quinoline?
2-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)quinoline has a molecular weight of 303.45 g/mol, XLogP of 6.11, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethylphenyl)-6-(2,2-dimethylpropyl)quinoline is sourced from PubChem (CID 138464254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).