C9H12N2O — CID 138464387
1,2,3,6,7,8-hexahydropyrido[3,4-b]azepin-9-one (PubChem CID 138464387) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 1,2,3,6,7,8-hexahydropyrido[3,4-b]azepin-9-one.
| Compound Name | 1,2,3,6,7,8-hexahydropyrido[3,4-b]azepin-9-one |
|---|---|
| PubChem CID | 138464387 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1,2,3,6,7,8-hexahydropyrido[3,4-b]azepin-9-one |
| SMILES | O=C1NCCC2=C1NCCC=C2 |
| InChI | InChI=1S/C9H12N2O/c12-9-8-7(4-6-11-9)3-1-2-5-10-8/h1,3,10H,2,4-6H2,(H,11,12) |
| InChIKey | DISZFQUDLTVZQF-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |