About 3-methyl-2,6,7,8-tetrahydropyrano[3,2-c]pyridin-5-one
3-methyl-2,6,7,8-tetrahydropyrano[3,2-c]pyridin-5-one (PubChem CID 138464389) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 3-methyl-2,6,7,8-tetrahydropyrano[3,2-c]pyridin-5-one.
Analyze 3-methyl-2,6,7,8-tetrahydropyrano[3,2-c]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,6,7,8-tetrahydropyrano[3,2-c]pyridin-5-one?
The IUPAC name of 3-methyl-2,6,7,8-tetrahydropyrano[3,2-c]pyridin-5-one (CID 138464389) is 3-methyl-2,6,7,8-tetrahydropyrano[3,2-c]pyridin-5-one.
What is the SMILES notation for 3-methyl-2,6,7,8-tetrahydropyrano[3,2-c]pyridin-5-one?
The canonical SMILES for 3-methyl-2,6,7,8-tetrahydropyrano[3,2-c]pyridin-5-one is CC1=CC2=C(CCNC2=O)OC1.
What is the InChIKey of 3-methyl-2,6,7,8-tetrahydropyrano[3,2-c]pyridin-5-one?
The InChIKey is MXPGABLISXIIRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-6-4-7-8(12-5-6)2-3-10-9(7)11/h4H,2-3,5H2,1H3,(H,10,11).
What are the key properties of 3-methyl-2,6,7,8-tetrahydropyrano[3,2-c]pyridin-5-one?
3-methyl-2,6,7,8-tetrahydropyrano[3,2-c]pyridin-5-one has a molecular weight of 165.19 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,6,7,8-tetrahydropyrano[3,2-c]pyridin-5-one is sourced from PubChem (CID 138464389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).