C24H26F6N2S — CID 138464570
4-(3,5-dimethylphenyl)-6,7-bis(3,3,3-trifluoro-2,2-dimethylpropyl)thieno[3,2-d]pyrimidine (PubChem CID 138464570) has the molecular formula C24H26F6N2S and a molecular weight of 488.54 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-6,7-bis(3,3,3-trifluoro-2,2-dimethylpropyl)thieno[3,2-d]pyrimidine.
| Compound Name | 4-(3,5-dimethylphenyl)-6,7-bis(3,3,3-trifluoro-2,2-dimethylpropyl)thieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 138464570 |
| Molecular Formula | C24H26F6N2S |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-6,7-bis(3,3,3-trifluoro-2,2-dimethylpropyl)thieno[3,2-d]pyrimidine |
| SMILES | Cc1cc(C)cc(-c2ncnc3c(CC(C)(C)C(F)(F)F)c(CC(C)(C)C(F)(F)F)sc23)c1 |
| InChI | InChI=1S/C24H26F6N2S/c1-13-7-14(2)9-15(8-13)18-20-19(32-12-31-18)16(10-21(3,4)23(25,26)27)17(33-20)11-22(5,6)24(28,29)30/h7-9,12H,10-11H2,1-6H3 |
| InChIKey | BRSLZLSDJKBOFP-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |