About (2Z,4E)-1-methoxy-5-(trifluoromethoxy)hexa-2,4-diene
(2Z,4E)-1-methoxy-5-(trifluoromethoxy)hexa-2,4-diene (PubChem CID 138465035) has the molecular formula C8H11F3O2
and a molecular weight of 196.17 g/mol. Its IUPAC name is (2Z,4E)-1-methoxy-5-(trifluoromethoxy)hexa-2,4-diene.
Molecular Properties
| Compound Name | (2Z,4E)-1-methoxy-5-(trifluoromethoxy)hexa-2,4-diene |
| PubChem CID | 138465035 |
| Molecular Formula | C8H11F3O2 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (2Z,4E)-1-methoxy-5-(trifluoromethoxy)hexa-2,4-diene |
| SMILES | COC/C=C\C=C(/C)OC(F)(F)F |
| InChI | InChI=1S/C8H11F3O2/c1-7(13-8(9,10)11)5-3-4-6-12-2/h3-5H,6H2,1-2H3/b4-3-,7-5+ |
| InChIKey | RVHGPXQHLXLUDM-QVXLNCAUSA-N |
| XLogP | 2.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-1-methoxy-5-(trifluoromethoxy)hexa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-1-methoxy-5-(trifluoromethoxy)hexa-2,4-diene?
The IUPAC name of (2Z,4E)-1-methoxy-5-(trifluoromethoxy)hexa-2,4-diene (CID 138465035) is (2Z,4E)-1-methoxy-5-(trifluoromethoxy)hexa-2,4-diene.
What is the SMILES notation for (2Z,4E)-1-methoxy-5-(trifluoromethoxy)hexa-2,4-diene?
The canonical SMILES for (2Z,4E)-1-methoxy-5-(trifluoromethoxy)hexa-2,4-diene is COC/C=C\C=C(/C)OC(F)(F)F.
What is the InChIKey of (2Z,4E)-1-methoxy-5-(trifluoromethoxy)hexa-2,4-diene?
The InChIKey is RVHGPXQHLXLUDM-QVXLNCAUSA-N. The full InChI is InChI=1S/C8H11F3O2/c1-7(13-8(9,10)11)5-3-4-6-12-2/h3-5H,6H2,1-2H3/b4-3-,7-5+.
What are the key properties of (2Z,4E)-1-methoxy-5-(trifluoromethoxy)hexa-2,4-diene?
(2Z,4E)-1-methoxy-5-(trifluoromethoxy)hexa-2,4-diene has a molecular weight of 196.17 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-1-methoxy-5-(trifluoromethoxy)hexa-2,4-diene is sourced from PubChem (CID 138465035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).