About (3Z,5Z)-3-fluoro-4-methoxyocta-3,5-diene
(3Z,5Z)-3-fluoro-4-methoxyocta-3,5-diene (PubChem CID 138465038) has the molecular formula C9H15FO
and a molecular weight of 158.22 g/mol. Its IUPAC name is (3Z,5Z)-3-fluoro-4-methoxyocta-3,5-diene.
Molecular Properties
| Compound Name | (3Z,5Z)-3-fluoro-4-methoxyocta-3,5-diene |
| PubChem CID | 138465038 |
| Molecular Formula | C9H15FO |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (3Z,5Z)-3-fluoro-4-methoxyocta-3,5-diene |
| SMILES | CC/C=C\C(OC)=C(\F)CC |
| InChI | InChI=1S/C9H15FO/c1-4-6-7-9(11-3)8(10)5-2/h6-7H,4-5H2,1-3H3/b7-6-,9-8- |
| InChIKey | RRMHFMFSGQNVTL-JPDBVBESSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5Z)-3-fluoro-4-methoxyocta-3,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-3-fluoro-4-methoxyocta-3,5-diene?
The IUPAC name of (3Z,5Z)-3-fluoro-4-methoxyocta-3,5-diene (CID 138465038) is (3Z,5Z)-3-fluoro-4-methoxyocta-3,5-diene.
What is the SMILES notation for (3Z,5Z)-3-fluoro-4-methoxyocta-3,5-diene?
The canonical SMILES for (3Z,5Z)-3-fluoro-4-methoxyocta-3,5-diene is CC/C=C\C(OC)=C(\F)CC.
What is the InChIKey of (3Z,5Z)-3-fluoro-4-methoxyocta-3,5-diene?
The InChIKey is RRMHFMFSGQNVTL-JPDBVBESSA-N. The full InChI is InChI=1S/C9H15FO/c1-4-6-7-9(11-3)8(10)5-2/h6-7H,4-5H2,1-3H3/b7-6-,9-8-.
What are the key properties of (3Z,5Z)-3-fluoro-4-methoxyocta-3,5-diene?
(3Z,5Z)-3-fluoro-4-methoxyocta-3,5-diene has a molecular weight of 158.22 g/mol, XLogP of 3.19, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-3-fluoro-4-methoxyocta-3,5-diene is sourced from PubChem (CID 138465038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).