C18H14Cl2N2O3 — CID 138465087
[3-(4-ethylphenyl)-1,2-oxazol-5-yl]methyl 2,5-dichloropyridine-3-carboxylate (PubChem CID 138465087) has the molecular formula C18H14Cl2N2O3 and a molecular weight of 377.23 g/mol. Its IUPAC name is [3-(4-ethylphenyl)-1,2-oxazol-5-yl]methyl 2,5-dichloropyridine-3-carboxylate.
| Compound Name | [3-(4-ethylphenyl)-1,2-oxazol-5-yl]methyl 2,5-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 138465087 |
| Molecular Formula | C18H14Cl2N2O3 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | [3-(4-ethylphenyl)-1,2-oxazol-5-yl]methyl 2,5-dichloropyridine-3-carboxylate |
| SMILES | CCc1ccc(-c2cc(COC(=O)c3cc(Cl)cnc3Cl)on2)cc1 |
| InChI | InChI=1S/C18H14Cl2N2O3/c1-2-11-3-5-12(6-4-11)16-8-14(25-22-16)10-24-18(23)15-7-13(19)9-21-17(15)20/h3-9H,2,10H2,1H3 |
| InChIKey | DFUCSFDRCPPNHE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|