About [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 6-phenoxypyridine-3-carboxylate
[3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 6-phenoxypyridine-3-carboxylate (PubChem CID 138465099) has the molecular formula C22H15ClN2O4
and a molecular weight of 406.83 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 6-phenoxypyridine-3-carboxylate.
Molecular Properties
| Compound Name | [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 6-phenoxypyridine-3-carboxylate |
| PubChem CID | 138465099 |
| Molecular Formula | C22H15ClN2O4 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 6-phenoxypyridine-3-carboxylate |
| SMILES | O=C(OCc1cc(-c2ccc(Cl)cc2)no1)c1ccc(Oc2ccccc2)nc1 |
| InChI | InChI=1S/C22H15ClN2O4/c23-17-9-6-15(7-10-17)20-12-19(29-25-20)14-27-22(26)16-8-11-21(24-13-16)28-18-4-2-1-3-5-18/h1-13H,14H2 |
| InChIKey | BXDDCUHXLUJBAD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 6-phenoxypyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 6-phenoxypyridine-3-carboxylate?
The IUPAC name of [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 6-phenoxypyridine-3-carboxylate (CID 138465099) is [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 6-phenoxypyridine-3-carboxylate.
What is the SMILES notation for [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 6-phenoxypyridine-3-carboxylate?
The canonical SMILES for [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 6-phenoxypyridine-3-carboxylate is O=C(OCc1cc(-c2ccc(Cl)cc2)no1)c1ccc(Oc2ccccc2)nc1.
What is the InChIKey of [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 6-phenoxypyridine-3-carboxylate?
The InChIKey is BXDDCUHXLUJBAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15ClN2O4/c23-17-9-6-15(7-10-17)20-12-19(29-25-20)14-27-22(26)16-8-11-21(24-13-16)28-18-4-2-1-3-5-18/h1-13H,14H2.
What are the key properties of [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 6-phenoxypyridine-3-carboxylate?
[3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 6-phenoxypyridine-3-carboxylate has a molecular weight of 406.83 g/mol, XLogP of 5.54, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 6-phenoxypyridine-3-carboxylate is sourced from PubChem (CID 138465099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).