C23H38O4 — CID 138465677
3-methoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-ene-1,2,4-triol (PubChem CID 138465677) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is 3-methoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-ene-1,2,4-triol.
| Compound Name | 3-methoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-ene-1,2,4-triol |
|---|---|
| PubChem CID | 138465677 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | 3-methoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-ene-1,2,4-triol |
| SMILES | COC1=C(O)C(O)C(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(C)C1O |
| InChI | InChI=1S/C23H38O4/c1-15(2)9-7-10-16(3)11-8-12-17(4)13-14-19-18(5)20(24)23(27-6)22(26)21(19)25/h9,11,13,18-21,24-26H,7-8,10,12,14H2,1-6H3/b16-11+,17-13+ |
| InChIKey | KZCIJULVNVXANX-IUBLYSDUSA-N |
| XLogP | 5.20 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|