C16H27F3N2O — CID 138465980
(Z)-N'-(2-ethoxyethyl)-N'-[(2E)-penta-2,4-dien-2-yl]-N-(2,2,2-trifluoroethyl)pent-2-ene-1,5-diamine (PubChem CID 138465980) has the molecular formula C16H27F3N2O and a molecular weight of 320.40 g/mol. Its IUPAC name is (Z)-N'-(2-ethoxyethyl)-N'-[(2E)-penta-2,4-dien-2-yl]-N-(2,2,2-trifluoroethyl)pent-2-ene-1,5-diamine.
| Compound Name | (Z)-N'-(2-ethoxyethyl)-N'-[(2E)-penta-2,4-dien-2-yl]-N-(2,2,2-trifluoroethyl)pent-2-ene-1,5-diamine |
|---|---|
| PubChem CID | 138465980 |
| Molecular Formula | C16H27F3N2O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | (Z)-N'-(2-ethoxyethyl)-N'-[(2E)-penta-2,4-dien-2-yl]-N-(2,2,2-trifluoroethyl)pent-2-ene-1,5-diamine |
| SMILES | C=C/C=C(\C)N(CC/C=C\CNCC(F)(F)F)CCOCC |
| InChI | InChI=1S/C16H27F3N2O/c1-4-9-15(3)21(12-13-22-5-2)11-8-6-7-10-20-14-16(17,18)19/h4,6-7,9,20H,1,5,8,10-14H2,2-3H3/b7-6-,15-9+ |
| InChIKey | MKFRPSPATSBQFT-KWMXLAOOSA-N |
| XLogP | 3.51 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|