C27H45N3 — CID 138465987
(E)-2-[(Z)-3,6-dimethyldec-1-enyl]-N'-[(1E,3Z,5E)-4-methyl-6-(methylideneamino)deca-1,3,5,9-tetraenyl]prop-1-ene-1,3-diamine (PubChem CID 138465987) has the molecular formula C27H45N3 and a molecular weight of 411.68 g/mol. Its IUPAC name is (E)-2-[(Z)-3,6-dimethyldec-1-enyl]-N'-[(1E,3Z,5E)-4-methyl-6-(methylideneamino)deca-1,3,5,9-tetraenyl]prop-1-ene-1,3-diamine.
| Compound Name | (E)-2-[(Z)-3,6-dimethyldec-1-enyl]-N'-[(1E,3Z,5E)-4-methyl-6-(methylideneamino)deca-1,3,5,9-tetraenyl]prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 138465987 |
| Molecular Formula | C27H45N3 |
| Molecular Weight | 411.68 g/mol |
| Exact Mass | 411.36 |
| IUPAC Name | (E)-2-[(Z)-3,6-dimethyldec-1-enyl]-N'-[(1E,3Z,5E)-4-methyl-6-(methylideneamino)deca-1,3,5,9-tetraenyl]prop-1-ene-1,3-diamine |
| SMILES | C=CCC/C(=C\C(C)=C/C=C/NCC(/C=C\C(C)CCC(C)CCCC)=C/N)N=C |
| InChI | InChI=1S/C27H45N3/c1-7-9-12-23(3)15-16-24(4)17-18-26(21-28)22-30-19-11-13-25(5)20-27(29-6)14-10-8-2/h8,11,13,17-21,23-24,30H,2,6-7,9-10,12,14-16,22,28H2,1,3-5H3/b18-17-,19-11+,25-13-,26-21+,27-20+ |
| InChIKey | ZHGOQPADNDOVFA-OVNJEZNTSA-N |
| XLogP | 7.23 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.68 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|