About 4-methylsulfanylbutyl 3,7-dimethyl-6-oxobicyclo[3.3.1]nonane-3-carboxylate
4-methylsulfanylbutyl 3,7-dimethyl-6-oxobicyclo[3.3.1]nonane-3-carboxylate (PubChem CID 138466110) has the molecular formula C17H28O3S
and a molecular weight of 312.48 g/mol. Its IUPAC name is 4-methylsulfanylbutyl 3,7-dimethyl-6-oxobicyclo[3.3.1]nonane-3-carboxylate.
Molecular Properties
| Compound Name | 4-methylsulfanylbutyl 3,7-dimethyl-6-oxobicyclo[3.3.1]nonane-3-carboxylate |
| PubChem CID | 138466110 |
| Molecular Formula | C17H28O3S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 4-methylsulfanylbutyl 3,7-dimethyl-6-oxobicyclo[3.3.1]nonane-3-carboxylate |
| SMILES | CSCCCCOC(=O)C1(C)CC2CC(C)C(=O)C(C2)C1 |
| InChI | InChI=1S/C17H28O3S/c1-12-8-13-9-14(15(12)18)11-17(2,10-13)16(19)20-6-4-5-7-21-3/h12-14H,4-11H2,1-3H3 |
| InChIKey | CAQRZVPROXNJRD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methylsulfanylbutyl 3,7-dimethyl-6-oxobicyclo[3.3.1]nonane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanylbutyl 3,7-dimethyl-6-oxobicyclo[3.3.1]nonane-3-carboxylate?
The IUPAC name of 4-methylsulfanylbutyl 3,7-dimethyl-6-oxobicyclo[3.3.1]nonane-3-carboxylate (CID 138466110) is 4-methylsulfanylbutyl 3,7-dimethyl-6-oxobicyclo[3.3.1]nonane-3-carboxylate.
What is the SMILES notation for 4-methylsulfanylbutyl 3,7-dimethyl-6-oxobicyclo[3.3.1]nonane-3-carboxylate?
The canonical SMILES for 4-methylsulfanylbutyl 3,7-dimethyl-6-oxobicyclo[3.3.1]nonane-3-carboxylate is CSCCCCOC(=O)C1(C)CC2CC(C)C(=O)C(C2)C1.
What is the InChIKey of 4-methylsulfanylbutyl 3,7-dimethyl-6-oxobicyclo[3.3.1]nonane-3-carboxylate?
The InChIKey is CAQRZVPROXNJRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O3S/c1-12-8-13-9-14(15(12)18)11-17(2,10-13)16(19)20-6-4-5-7-21-3/h12-14H,4-11H2,1-3H3.
What are the key properties of 4-methylsulfanylbutyl 3,7-dimethyl-6-oxobicyclo[3.3.1]nonane-3-carboxylate?
4-methylsulfanylbutyl 3,7-dimethyl-6-oxobicyclo[3.3.1]nonane-3-carboxylate has a molecular weight of 312.48 g/mol, XLogP of 3.70, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanylbutyl 3,7-dimethyl-6-oxobicyclo[3.3.1]nonane-3-carboxylate is sourced from PubChem (CID 138466110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).