C32H33NP2 — CID 138466221
(2S,5S)-N-cyclobutyl-N-diphenylphosphanyl-2,5-diphenylphospholan-1-amine (PubChem CID 138466221) has the molecular formula C32H33NP2 and a molecular weight of 493.57 g/mol. Its IUPAC name is (2S,5S)-N-cyclobutyl-N-diphenylphosphanyl-2,5-diphenylphospholan-1-amine.
| Compound Name | (2S,5S)-N-cyclobutyl-N-diphenylphosphanyl-2,5-diphenylphospholan-1-amine |
|---|---|
| PubChem CID | 138466221 |
| Molecular Formula | C32H33NP2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | (2S,5S)-N-cyclobutyl-N-diphenylphosphanyl-2,5-diphenylphospholan-1-amine |
| SMILES | c1ccc([C@@H]2CC[C@@H](c3ccccc3)P2N(C2CCC2)P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H33NP2/c1-5-14-26(15-6-1)31-24-25-32(27-16-7-2-8-17-27)35(31)33(28-18-13-19-28)34(29-20-9-3-10-21-29)30-22-11-4-12-23-30/h1-12,14-17,20-23,28,31-32H,13,18-19,24-25H2/t31-,32-/m0/s1 |
| InChIKey | QDLATQCCURLPCI-ACHIHNKUSA-N |
| XLogP | 8.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|