C15H22F10O3 — CID 138466995
2,2,3,3,4,4-hexafluoro-1-propan-2-yloxy-5-[2,2,3,3-tetrafluoro-3-[(2-methylpropan-2-yl)oxy]propoxy]pentane (PubChem CID 138466995) has the molecular formula C15H22F10O3 and a molecular weight of 440.32 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-1-propan-2-yloxy-5-[2,2,3,3-tetrafluoro-3-[(2-methylpropan-2-yl)oxy]propoxy]pentane.
| Compound Name | 2,2,3,3,4,4-hexafluoro-1-propan-2-yloxy-5-[2,2,3,3-tetrafluoro-3-[(2-methylpropan-2-yl)oxy]propoxy]pentane |
|---|---|
| PubChem CID | 138466995 |
| Molecular Formula | C15H22F10O3 |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-1-propan-2-yloxy-5-[2,2,3,3-tetrafluoro-3-[(2-methylpropan-2-yl)oxy]propoxy]pentane |
| SMILES | CC(C)OCC(F)(F)C(F)(F)C(F)(F)COCC(F)(F)C(F)(F)OC(C)(C)C |
| InChI | InChI=1S/C15H22F10O3/c1-9(2)27-8-12(18,19)14(22,23)11(16,17)6-26-7-13(20,21)15(24,25)28-10(3,4)5/h9H,6-8H2,1-5H3 |
| InChIKey | UEHQNNZWIXDXPR-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|