C12H13FN2O4S — CID 138467538
N-(2,6-dioxopiperidin-3-yl)-4-fluoro-N-methylbenzenesulfonamide (PubChem CID 138467538) has the molecular formula C12H13FN2O4S and a molecular weight of 300.31 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-4-fluoro-N-methylbenzenesulfonamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-4-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 138467538 |
| Molecular Formula | C12H13FN2O4S |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-4-fluoro-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCC(=O)NC1=O)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H13FN2O4S/c1-15(10-6-7-11(16)14-12(10)17)20(18,19)9-4-2-8(13)3-5-9/h2-5,10H,6-7H2,1H3,(H,14,16,17) |
| InChIKey | KMPSMYPPWFIEPX-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|