C23H31NO2 — CID 138467712
8-[(6R)-6-[(E)-hex-1-enyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-3-oxa-1-azaspiro[4.4]nonan-2-one (PubChem CID 138467712) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 8-[(6R)-6-[(E)-hex-1-enyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-3-oxa-1-azaspiro[4.4]nonan-2-one.
| Compound Name | 8-[(6R)-6-[(E)-hex-1-enyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-3-oxa-1-azaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 138467712 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 8-[(6R)-6-[(E)-hex-1-enyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-3-oxa-1-azaspiro[4.4]nonan-2-one |
| SMILES | CCCC/C=C/[C@@H]1CCc2cc(C3CCC4(COC(=O)N4)C3)ccc2C1 |
| InChI | InChI=1S/C23H31NO2/c1-2-3-4-5-6-17-7-8-19-14-20(10-9-18(19)13-17)21-11-12-23(15-21)16-26-22(25)24-23/h5-6,9-10,14,17,21H,2-4,7-8,11-13,15-16H2,1H3,(H,24,25)/b6-5+/t17-,21?,23?/m1/s1 |
| InChIKey | XHRWOLBLPGRDFY-HRQMJEIHSA-N |
| XLogP | 5.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|