C36H15F12NO — CID 138468150
2-[6-[4-[difluoro-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxymethyl]-3,5-difluorophenyl]-5,7-difluoronaphthalen-2-yl]-5-methylpyridine (PubChem CID 138468150) has the molecular formula C36H15F12NO and a molecular weight of 705.50 g/mol. Its IUPAC name is 2-[6-[4-[difluoro-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxymethyl]-3,5-difluorophenyl]-5,7-difluoronaphthalen-2-yl]-5-methylpyridine.
| Compound Name | 2-[6-[4-[difluoro-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxymethyl]-3,5-difluorophenyl]-5,7-difluoronaphthalen-2-yl]-5-methylpyridine |
|---|---|
| PubChem CID | 138468150 |
| Molecular Formula | C36H15F12NO |
| Molecular Weight | 705.50 g/mol |
| Exact Mass | 705.10 |
| IUPAC Name | 2-[6-[4-[difluoro-[4,5,7-trifluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxymethyl]-3,5-difluorophenyl]-5,7-difluoronaphthalen-2-yl]-5-methylpyridine |
| SMILES | Cc1ccc(-c2ccc3c(F)c(-c4cc(F)c(C(F)(F)Oc5cc(F)c6c(F)c(C#CC(F)(F)F)c(F)cc6c5)c(F)c4)c(F)cc3c2)nc1 |
| InChI | InChI=1S/C36H15F12NO/c1-16-2-5-29(49-15-16)17-3-4-22-18(8-17)10-25(38)31(33(22)42)20-12-27(40)32(28(41)13-20)36(47,48)50-21-9-19-11-24(37)23(6-7-35(44,45)46)34(43)30(19)26(39)14-21/h2-5,8-15H,1H3 |
| InChIKey | QULVVWBBVIVQRV-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.50 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|