About 2-[1-(6,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonic acid
2-[1-(6,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonic acid (PubChem CID 138468655) has the molecular formula C17H24N3O5P
and a molecular weight of 381.37 g/mol. Its IUPAC name is 2-[1-(6,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonic acid.
Molecular Properties
| Compound Name | 2-[1-(6,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonic acid |
| PubChem CID | 138468655 |
| Molecular Formula | C17H24N3O5P |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[1-(6,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonic acid |
| SMILES | COc1cc(OC)c2ncnc(N3CCC(CCP(=O)(O)O)CC3)c2c1 |
| InChI | InChI=1S/C17H24N3O5P/c1-24-13-9-14-16(15(10-13)25-2)18-11-19-17(14)20-6-3-12(4-7-20)5-8-26(21,22)23/h9-12H,3-8H2,1-2H3,(H2,21,22,23) |
| InChIKey | DEBNNSDEFAZYSR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(6,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(6,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonic acid?
The IUPAC name of 2-[1-(6,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonic acid (CID 138468655) is 2-[1-(6,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonic acid.
What is the SMILES notation for 2-[1-(6,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonic acid?
The canonical SMILES for 2-[1-(6,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonic acid is COc1cc(OC)c2ncnc(N3CCC(CCP(=O)(O)O)CC3)c2c1.
What is the InChIKey of 2-[1-(6,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonic acid?
The InChIKey is DEBNNSDEFAZYSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N3O5P/c1-24-13-9-14-16(15(10-13)25-2)18-11-19-17(14)20-6-3-12(4-7-20)5-8-26(21,22)23/h9-12H,3-8H2,1-2H3,(H2,21,22,23).
What are the key properties of 2-[1-(6,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonic acid?
2-[1-(6,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonic acid has a molecular weight of 381.37 g/mol, XLogP of 2.43, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(6,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethylphosphonic acid is sourced from PubChem (CID 138468655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).