C22H36O5 — CID 138468997
8-(7-hexyl-1-hydroxy-3-oxo-3a,4,7,7a-tetrahydro-1H-2-benzofuran-4-yl)octanoic acid (PubChem CID 138468997) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is 8-(7-hexyl-1-hydroxy-3-oxo-3a,4,7,7a-tetrahydro-1H-2-benzofuran-4-yl)octanoic acid.
| Compound Name | 8-(7-hexyl-1-hydroxy-3-oxo-3a,4,7,7a-tetrahydro-1H-2-benzofuran-4-yl)octanoic acid |
|---|---|
| PubChem CID | 138468997 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 8-(7-hexyl-1-hydroxy-3-oxo-3a,4,7,7a-tetrahydro-1H-2-benzofuran-4-yl)octanoic acid |
| SMILES | CCCCCCC1C=CC(CCCCCCCC(=O)O)C2C(=O)OC(O)C12 |
| InChI | InChI=1S/C22H36O5/c1-2-3-4-8-11-16-14-15-17(20-19(16)21(25)27-22(20)26)12-9-6-5-7-10-13-18(23)24/h14-17,19-21,25H,2-13H2,1H3,(H,23,24) |
| InChIKey | CCWBWYISJFGZSG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|