C32H42O8 — CID 138469354
1-O-benzyl 2-O-[(3S,5R,8R,9S,10S,12R,13S,14S,17R)-12,14-dihydroxy-10,13-dimethyl-17-(5-oxooxolan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] oxalate (PubChem CID 138469354) has the molecular formula C32H42O8 and a molecular weight of 554.68 g/mol. Its IUPAC name is 1-O-benzyl 2-O-[(3S,5R,8R,9S,10S,12R,13S,14S,17R)-12,14-dihydroxy-10,13-dimethyl-17-(5-oxooxolan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] oxalate.
| Compound Name | 1-O-benzyl 2-O-[(3S,5R,8R,9S,10S,12R,13S,14S,17R)-12,14-dihydroxy-10,13-dimethyl-17-(5-oxooxolan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] oxalate |
|---|---|
| PubChem CID | 138469354 |
| Molecular Formula | C32H42O8 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | 1-O-benzyl 2-O-[(3S,5R,8R,9S,10S,12R,13S,14S,17R)-12,14-dihydroxy-10,13-dimethyl-17-(5-oxooxolan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] oxalate |
| SMILES | C[C@]12CC[C@H](OC(=O)C(=O)OCc3ccccc3)C[C@H]1CC[C@@H]1[C@@H]2C[C@@H](O)[C@]2(C)[C@@H](C3COC(=O)C3)CC[C@]12O |
| InChI | InChI=1S/C32H42O8/c1-30-12-10-22(40-29(36)28(35)39-17-19-6-4-3-5-7-19)15-21(30)8-9-24-25(30)16-26(33)31(2)23(11-13-32(24,31)37)20-14-27(34)38-18-20/h3-7,20-26,33,37H,8-18H2,1-2H3/t20?,21-,22+,23-,24-,25+,26-,30+,31+,32+/m1/s1 |
| InChIKey | MHCMPQPBFBMYBZ-NDWQDQAGSA-N |
| XLogP | 3.95 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|