C34H30ClF3N6O3 — CID 138469406
2,2,2-trifluoroethyl 4-[3-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]phenyl]piperidine-1-carboxylate (PubChem CID 138469406) has the molecular formula C34H30ClF3N6O3 and a molecular weight of 663.10 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-[3-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]phenyl]piperidine-1-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 4-[3-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 138469406 |
| Molecular Formula | C34H30ClF3N6O3 |
| Molecular Weight | 663.10 g/mol |
| Exact Mass | 662.20 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-[3-[1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-2-phenylethyl]phenyl]piperidine-1-carboxylate |
| SMILES | O=C(OCC(F)(F)F)N1CCC(c2cccc(C(Cc3ccccc3)c3ccc(-c4cc(Cl)ccc4-n4cnnn4)c[n+]3[O-])c2)CC1 |
| InChI | InChI=1S/C34H30ClF3N6O3/c35-28-10-12-31(43-22-39-40-41-43)30(19-28)27-9-11-32(44(46)20-27)29(17-23-5-2-1-3-6-23)26-8-4-7-25(18-26)24-13-15-42(16-14-24)33(45)47-21-34(36,37)38/h1-12,18-20,22,24,29H,13-17,21H2 |
| InChIKey | ZTXNTZHDYXLHQU-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 100.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.10 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|