C27H26Cl2FN3O3 — CID 138471110
4-[(1S,3R,4S,5R)-5-[[3-(2,6-dichloro-4-cyclopropylphenyl)-1H-pyrazol-5-yl]methoxy]-3-methyl-2-azabicyclo[2.2.1]heptan-2-yl]-2-fluorobenzoic acid (PubChem CID 138471110) has the molecular formula C27H26Cl2FN3O3 and a molecular weight of 530.43 g/mol. Its IUPAC name is 4-[(1S,3R,4S,5R)-5-[[3-(2,6-dichloro-4-cyclopropylphenyl)-1H-pyrazol-5-yl]methoxy]-3-methyl-2-azabicyclo[2.2.1]heptan-2-yl]-2-fluorobenzoic acid.
| Compound Name | 4-[(1S,3R,4S,5R)-5-[[3-(2,6-dichloro-4-cyclopropylphenyl)-1H-pyrazol-5-yl]methoxy]-3-methyl-2-azabicyclo[2.2.1]heptan-2-yl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 138471110 |
| Molecular Formula | C27H26Cl2FN3O3 |
| Molecular Weight | 530.43 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 4-[(1S,3R,4S,5R)-5-[[3-(2,6-dichloro-4-cyclopropylphenyl)-1H-pyrazol-5-yl]methoxy]-3-methyl-2-azabicyclo[2.2.1]heptan-2-yl]-2-fluorobenzoic acid |
| SMILES | C[C@@H]1[C@@H]2C[C@@H](C[C@H]2OCc2cc(-c3c(Cl)cc(C4CC4)cc3Cl)n[nH]2)N1c1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C27H26Cl2FN3O3/c1-13-20-9-18(33(13)17-4-5-19(27(34)35)23(30)10-17)11-25(20)36-12-16-8-24(32-31-16)26-21(28)6-15(7-22(26)29)14-2-3-14/h4-8,10,13-14,18,20,25H,2-3,9,11-12H2,1H3,(H,31,32)(H,34,35)/t13-,18+,20+,25-/m1/s1 |
| InChIKey | DSZUMJPCJPLFTN-OFDKLFKSSA-N |
| XLogP | 6.67 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.43 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |