C28H28Cl2FN3O3 — CID 138471141
4-[(1S,3R,4S,5R)-5-[[3-(2,6-dichloro-4-cyclopropylphenyl)-1H-pyrazol-5-yl]methoxy]-3-ethyl-2-azabicyclo[2.2.1]heptan-2-yl]-2-fluorobenzoic acid (PubChem CID 138471141) has the molecular formula C28H28Cl2FN3O3 and a molecular weight of 544.45 g/mol. Its IUPAC name is 4-[(1S,3R,4S,5R)-5-[[3-(2,6-dichloro-4-cyclopropylphenyl)-1H-pyrazol-5-yl]methoxy]-3-ethyl-2-azabicyclo[2.2.1]heptan-2-yl]-2-fluorobenzoic acid.
| Compound Name | 4-[(1S,3R,4S,5R)-5-[[3-(2,6-dichloro-4-cyclopropylphenyl)-1H-pyrazol-5-yl]methoxy]-3-ethyl-2-azabicyclo[2.2.1]heptan-2-yl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 138471141 |
| Molecular Formula | C28H28Cl2FN3O3 |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 4-[(1S,3R,4S,5R)-5-[[3-(2,6-dichloro-4-cyclopropylphenyl)-1H-pyrazol-5-yl]methoxy]-3-ethyl-2-azabicyclo[2.2.1]heptan-2-yl]-2-fluorobenzoic acid |
| SMILES | CC[C@@H]1[C@@H]2C[C@@H](C[C@H]2OCc2cc(-c3c(Cl)cc(C4CC4)cc3Cl)n[nH]2)N1c1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C28H28Cl2FN3O3/c1-2-25-20-10-18(34(25)17-5-6-19(28(35)36)23(31)11-17)12-26(20)37-13-16-9-24(33-32-16)27-21(29)7-15(8-22(27)30)14-3-4-14/h5-9,11,14,18,20,25-26H,2-4,10,12-13H2,1H3,(H,32,33)(H,35,36)/t18-,20-,25+,26+/m0/s1 |
| InChIKey | BHBYIXWPBPVHQW-TYTZFVCUSA-N |
| XLogP | 7.06 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |