About [3-cyclopropyl-4-(2,6-dichlorophenyl)-1H-pyrazol-5-yl]methanol
[3-cyclopropyl-4-(2,6-dichlorophenyl)-1H-pyrazol-5-yl]methanol (PubChem CID 138471189) has the molecular formula C13H12Cl2N2O
and a molecular weight of 283.16 g/mol. Its IUPAC name is [3-cyclopropyl-4-(2,6-dichlorophenyl)-1H-pyrazol-5-yl]methanol.
Molecular Properties
| Compound Name | [3-cyclopropyl-4-(2,6-dichlorophenyl)-1H-pyrazol-5-yl]methanol |
| PubChem CID | 138471189 |
| Molecular Formula | C13H12Cl2N2O |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | [3-cyclopropyl-4-(2,6-dichlorophenyl)-1H-pyrazol-5-yl]methanol |
| SMILES | OCc1[nH]nc(C2CC2)c1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H12Cl2N2O/c14-8-2-1-3-9(15)11(8)12-10(6-18)16-17-13(12)7-4-5-7/h1-3,7,18H,4-6H2,(H,16,17) |
| InChIKey | GUFVJPDYGFSSAH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-cyclopropyl-4-(2,6-dichlorophenyl)-1H-pyrazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-cyclopropyl-4-(2,6-dichlorophenyl)-1H-pyrazol-5-yl]methanol?
The IUPAC name of [3-cyclopropyl-4-(2,6-dichlorophenyl)-1H-pyrazol-5-yl]methanol (CID 138471189) is [3-cyclopropyl-4-(2,6-dichlorophenyl)-1H-pyrazol-5-yl]methanol.
What is the SMILES notation for [3-cyclopropyl-4-(2,6-dichlorophenyl)-1H-pyrazol-5-yl]methanol?
The canonical SMILES for [3-cyclopropyl-4-(2,6-dichlorophenyl)-1H-pyrazol-5-yl]methanol is OCc1[nH]nc(C2CC2)c1-c1c(Cl)cccc1Cl.
What is the InChIKey of [3-cyclopropyl-4-(2,6-dichlorophenyl)-1H-pyrazol-5-yl]methanol?
The InChIKey is GUFVJPDYGFSSAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2N2O/c14-8-2-1-3-9(15)11(8)12-10(6-18)16-17-13(12)7-4-5-7/h1-3,7,18H,4-6H2,(H,16,17).
What are the key properties of [3-cyclopropyl-4-(2,6-dichlorophenyl)-1H-pyrazol-5-yl]methanol?
[3-cyclopropyl-4-(2,6-dichlorophenyl)-1H-pyrazol-5-yl]methanol has a molecular weight of 283.16 g/mol, XLogP of 3.75, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-cyclopropyl-4-(2,6-dichlorophenyl)-1H-pyrazol-5-yl]methanol is sourced from PubChem (CID 138471189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).