About 2-(3-methyl-1,2,4-triazol-4-yl)-1H-pyridin-4-one
2-(3-methyl-1,2,4-triazol-4-yl)-1H-pyridin-4-one (PubChem CID 138471366) has the molecular formula C8H8N4O
and a molecular weight of 176.18 g/mol. Its IUPAC name is 2-(3-methyl-1,2,4-triazol-4-yl)-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 2-(3-methyl-1,2,4-triazol-4-yl)-1H-pyridin-4-one |
| PubChem CID | 138471366 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 2-(3-methyl-1,2,4-triazol-4-yl)-1H-pyridin-4-one |
| SMILES | Cc1nncn1-c1cc(=O)cc[nH]1 |
| InChI | InChI=1S/C8H8N4O/c1-6-11-10-5-12(6)8-4-7(13)2-3-9-8/h2-5H,1H3,(H,9,13) |
| InChIKey | TUWQCPPXIFJAKW-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-methyl-1,2,4-triazol-4-yl)-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-1,2,4-triazol-4-yl)-1H-pyridin-4-one?
The IUPAC name of 2-(3-methyl-1,2,4-triazol-4-yl)-1H-pyridin-4-one (CID 138471366) is 2-(3-methyl-1,2,4-triazol-4-yl)-1H-pyridin-4-one.
What is the SMILES notation for 2-(3-methyl-1,2,4-triazol-4-yl)-1H-pyridin-4-one?
The canonical SMILES for 2-(3-methyl-1,2,4-triazol-4-yl)-1H-pyridin-4-one is Cc1nncn1-c1cc(=O)cc[nH]1.
What is the InChIKey of 2-(3-methyl-1,2,4-triazol-4-yl)-1H-pyridin-4-one?
The InChIKey is TUWQCPPXIFJAKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O/c1-6-11-10-5-12(6)8-4-7(13)2-3-9-8/h2-5H,1H3,(H,9,13).
What are the key properties of 2-(3-methyl-1,2,4-triazol-4-yl)-1H-pyridin-4-one?
2-(3-methyl-1,2,4-triazol-4-yl)-1H-pyridin-4-one has a molecular weight of 176.18 g/mol, XLogP of 0.26, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-1,2,4-triazol-4-yl)-1H-pyridin-4-one is sourced from PubChem (CID 138471366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).