C22H25ClF4N6O2 — CID 138471919
4-chloro-5-[1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,6,7,7a-tetrahydro-3aH-triazolo[4,5-c]pyridin-5-yl]-2-(oxan-2-yl)-4,5-dihydropyridazin-3-one (PubChem CID 138471919) has the molecular formula C22H25ClF4N6O2 and a molecular weight of 516.93 g/mol. Its IUPAC name is 4-chloro-5-[1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,6,7,7a-tetrahydro-3aH-triazolo[4,5-c]pyridin-5-yl]-2-(oxan-2-yl)-4,5-dihydropyridazin-3-one.
| Compound Name | 4-chloro-5-[1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,6,7,7a-tetrahydro-3aH-triazolo[4,5-c]pyridin-5-yl]-2-(oxan-2-yl)-4,5-dihydropyridazin-3-one |
|---|---|
| PubChem CID | 138471919 |
| Molecular Formula | C22H25ClF4N6O2 |
| Molecular Weight | 516.93 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 4-chloro-5-[1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-4,6,7,7a-tetrahydro-3aH-triazolo[4,5-c]pyridin-5-yl]-2-(oxan-2-yl)-4,5-dihydropyridazin-3-one |
| SMILES | O=C1C(Cl)C(N2CCC3C(C2)N=NN3Cc2ccc(F)cc2C(F)(F)F)C=NN1C1CCCCO1 |
| InChI | InChI=1S/C22H25ClF4N6O2/c23-20-18(10-28-33(21(20)34)19-3-1-2-8-35-19)31-7-6-17-16(12-31)29-30-32(17)11-13-4-5-14(24)9-15(13)22(25,26)27/h4-5,9-10,16-20H,1-3,6-8,11-12H2 |
| InChIKey | WALDSKHKJWAVON-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.93 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|