About 1-[(2-bromophenyl)methyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylic acid
1-[(2-bromophenyl)methyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylic acid (PubChem CID 138472077) has the molecular formula C13H13BrN4O2
and a molecular weight of 337.18 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(2-bromophenyl)methyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylic acid |
| PubChem CID | 138472077 |
| Molecular Formula | C13H13BrN4O2 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylic acid |
| SMILES | O=C(O)N1CCc2c(nnn2Cc2ccccc2Br)C1 |
| InChI | InChI=1S/C13H13BrN4O2/c14-10-4-2-1-3-9(10)7-18-12-5-6-17(13(19)20)8-11(12)15-16-18/h1-4H,5-8H2,(H,19,20) |
| InChIKey | UBVYLRZAIOVXGL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2-bromophenyl)methyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-bromophenyl)methyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylic acid?
The IUPAC name of 1-[(2-bromophenyl)methyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylic acid (CID 138472077) is 1-[(2-bromophenyl)methyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylic acid.
What is the SMILES notation for 1-[(2-bromophenyl)methyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylic acid?
The canonical SMILES for 1-[(2-bromophenyl)methyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylic acid is O=C(O)N1CCc2c(nnn2Cc2ccccc2Br)C1.
What is the InChIKey of 1-[(2-bromophenyl)methyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylic acid?
The InChIKey is UBVYLRZAIOVXGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrN4O2/c14-10-4-2-1-3-9(10)7-18-12-5-6-17(13(19)20)8-11(12)15-16-18/h1-4H,5-8H2,(H,19,20).
What are the key properties of 1-[(2-bromophenyl)methyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylic acid?
1-[(2-bromophenyl)methyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylic acid has a molecular weight of 337.18 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-bromophenyl)methyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylic acid is sourced from PubChem (CID 138472077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).