C13H14F4N4 — CID 138472121
1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3a,4,5,6,7,7a-hexahydrotriazolo[4,5-c]pyridine (PubChem CID 138472121) has the molecular formula C13H14F4N4 and a molecular weight of 302.28 g/mol. Its IUPAC name is 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3a,4,5,6,7,7a-hexahydrotriazolo[4,5-c]pyridine.
| Compound Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3a,4,5,6,7,7a-hexahydrotriazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 138472121 |
| Molecular Formula | C13H14F4N4 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3a,4,5,6,7,7a-hexahydrotriazolo[4,5-c]pyridine |
| SMILES | Fc1ccc(CN2N=NC3CNCCC32)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F4N4/c14-9-2-1-8(10(5-9)13(15,16)17)7-21-12-3-4-18-6-11(12)19-20-21/h1-2,5,11-12,18H,3-4,6-7H2 |
| InChIKey | OUJHTCPLBLAREX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |