About 3-(1-chloroethyl)-2-(2,2-difluoroethyl)pyridine
3-(1-chloroethyl)-2-(2,2-difluoroethyl)pyridine (PubChem CID 138472175) has the molecular formula C9H10ClF2N
and a molecular weight of 205.64 g/mol. Its IUPAC name is 3-(1-chloroethyl)-2-(2,2-difluoroethyl)pyridine.
Molecular Properties
| Compound Name | 3-(1-chloroethyl)-2-(2,2-difluoroethyl)pyridine |
| PubChem CID | 138472175 |
| Molecular Formula | C9H10ClF2N |
| Molecular Weight | 205.64 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 3-(1-chloroethyl)-2-(2,2-difluoroethyl)pyridine |
| SMILES | CC(Cl)c1cccnc1CC(F)F |
| InChI | InChI=1S/C9H10ClF2N/c1-6(10)7-3-2-4-13-8(7)5-9(11)12/h2-4,6,9H,5H2,1H3 |
| InChIKey | IBYCYHBTSPGPMX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.64 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-chloroethyl)-2-(2,2-difluoroethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-chloroethyl)-2-(2,2-difluoroethyl)pyridine?
The IUPAC name of 3-(1-chloroethyl)-2-(2,2-difluoroethyl)pyridine (CID 138472175) is 3-(1-chloroethyl)-2-(2,2-difluoroethyl)pyridine.
What is the SMILES notation for 3-(1-chloroethyl)-2-(2,2-difluoroethyl)pyridine?
The canonical SMILES for 3-(1-chloroethyl)-2-(2,2-difluoroethyl)pyridine is CC(Cl)c1cccnc1CC(F)F.
What is the InChIKey of 3-(1-chloroethyl)-2-(2,2-difluoroethyl)pyridine?
The InChIKey is IBYCYHBTSPGPMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClF2N/c1-6(10)7-3-2-4-13-8(7)5-9(11)12/h2-4,6,9H,5H2,1H3.
What are the key properties of 3-(1-chloroethyl)-2-(2,2-difluoroethyl)pyridine?
3-(1-chloroethyl)-2-(2,2-difluoroethyl)pyridine has a molecular weight of 205.64 g/mol, XLogP of 3.19, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-chloroethyl)-2-(2,2-difluoroethyl)pyridine is sourced from PubChem (CID 138472175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).