C14H20ClN3O3 — CID 138472198
4-chloro-5-(4-hydroxypiperidin-1-yl)-2-(oxan-2-yl)pyridazin-3-one (PubChem CID 138472198) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is 4-chloro-5-(4-hydroxypiperidin-1-yl)-2-(oxan-2-yl)pyridazin-3-one.
| Compound Name | 4-chloro-5-(4-hydroxypiperidin-1-yl)-2-(oxan-2-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 138472198 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 4-chloro-5-(4-hydroxypiperidin-1-yl)-2-(oxan-2-yl)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(N2CCC(O)CC2)cnn1C1CCCCO1 |
| InChI | InChI=1S/C14H20ClN3O3/c15-13-11(17-6-4-10(19)5-7-17)9-16-18(14(13)20)12-3-1-2-8-21-12/h9-10,12,19H,1-8H2 |
| InChIKey | MCAVXYZUMYQVAY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |