C18H26F3N3O5S — CID 138472214
tert-butyl 4-[[2-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)-3-pyridinyl]methyl]piperazine-1-carboxylate (PubChem CID 138472214) has the molecular formula C18H26F3N3O5S and a molecular weight of 453.48 g/mol. Its IUPAC name is tert-butyl 4-[[2-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)-3-pyridinyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)-3-pyridinyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 138472214 |
| Molecular Formula | C18H26F3N3O5S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | tert-butyl 4-[[2-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)-3-pyridinyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2cccnc2C(OS(C)(=O)=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H26F3N3O5S/c1-17(2,3)28-16(25)24-10-8-23(9-11-24)12-13-6-5-7-22-14(13)15(18(19,20)21)29-30(4,26)27/h5-7,15H,8-12H2,1-4H3 |
| InChIKey | VKWKGDIFMLILOB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|