About 6-methylsulfonyl-3H-2-benzofuran-1-one;3-oxo-1H-2-benzofuran-5-sulfonyl chloride
6-methylsulfonyl-3H-2-benzofuran-1-one;3-oxo-1H-2-benzofuran-5-sulfonyl chloride (PubChem CID 138472758) has the molecular formula C17H13ClO8S2
and a molecular weight of 444.87 g/mol. Its IUPAC name is 6-methylsulfonyl-3H-2-benzofuran-1-one;3-oxo-1H-2-benzofuran-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 6-methylsulfonyl-3H-2-benzofuran-1-one;3-oxo-1H-2-benzofuran-5-sulfonyl chloride |
| PubChem CID | 138472758 |
| Molecular Formula | C17H13ClO8S2 |
| Molecular Weight | 444.87 g/mol |
| Exact Mass | 443.97 |
| IUPAC Name | 6-methylsulfonyl-3H-2-benzofuran-1-one;3-oxo-1H-2-benzofuran-5-sulfonyl chloride |
| SMILES | CS(=O)(=O)c1ccc2c(c1)C(=O)OC2.O=C1OCc2ccc(S(=O)(=O)Cl)cc21 |
| InChI | InChI=1S/C9H8O4S.C8H5ClO4S/c1-14(11,12)7-3-2-6-5-13-9(10)8(6)4-7;9-14(11,12)6-2-1-5-4-13-8(10)7(5)3-6/h2-4H,5H2,1H3;1-3H,4H2 |
| InChIKey | OAPZFLLVHOZQLI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.87 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 6-methylsulfonyl-3H-2-benzofuran-1-one;3-oxo-1H-2-benzofuran-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylsulfonyl-3H-2-benzofuran-1-one;3-oxo-1H-2-benzofuran-5-sulfonyl chloride?
The IUPAC name of 6-methylsulfonyl-3H-2-benzofuran-1-one;3-oxo-1H-2-benzofuran-5-sulfonyl chloride (CID 138472758) is 6-methylsulfonyl-3H-2-benzofuran-1-one;3-oxo-1H-2-benzofuran-5-sulfonyl chloride.
What is the SMILES notation for 6-methylsulfonyl-3H-2-benzofuran-1-one;3-oxo-1H-2-benzofuran-5-sulfonyl chloride?
The canonical SMILES for 6-methylsulfonyl-3H-2-benzofuran-1-one;3-oxo-1H-2-benzofuran-5-sulfonyl chloride is CS(=O)(=O)c1ccc2c(c1)C(=O)OC2.O=C1OCc2ccc(S(=O)(=O)Cl)cc21.
What is the InChIKey of 6-methylsulfonyl-3H-2-benzofuran-1-one;3-oxo-1H-2-benzofuran-5-sulfonyl chloride?
The InChIKey is OAPZFLLVHOZQLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4S.C8H5ClO4S/c1-14(11,12)7-3-2-6-5-13-9(10)8(6)4-7;9-14(11,12)6-2-1-5-4-13-8(10)7(5)3-6/h2-4H,5H2,1H3;1-3H,4H2.
What are the key properties of 6-methylsulfonyl-3H-2-benzofuran-1-one;3-oxo-1H-2-benzofuran-5-sulfonyl chloride?
6-methylsulfonyl-3H-2-benzofuran-1-one;3-oxo-1H-2-benzofuran-5-sulfonyl chloride has a molecular weight of 444.87 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylsulfonyl-3H-2-benzofuran-1-one;3-oxo-1H-2-benzofuran-5-sulfonyl chloride is sourced from PubChem (CID 138472758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).